C10H9N2O3+ — CID 6331943
imino-(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)azanium (PubChem CID 6331943) has the molecular formula C10H9N2O3+ and a molecular weight of 205.19 g/mol. Its IUPAC name is imino-(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)azanium.
| Compound Name | imino-(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)azanium |
|---|---|
| PubChem CID | 6331943 |
| Molecular Formula | C10H9N2O3+ |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | imino-(1-methoxy-1,3-dioxo-3-phenylpropan-2-ylidene)azanium |
| SMILES | COC(=O)C(=[N+]=N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H9N2O3/c1-15-10(14)8(12-11)9(13)7-5-3-2-4-6-7/h2-6,11H,1H3/q+1 |
| InChIKey | AGDNKJGGZUIMOS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|