About 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide
6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide (PubChem CID 6332195) has the molecular formula C6H7BrNO+
and a molecular weight of 189.03 g/mol. Its IUPAC name is 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide.
Molecular Properties
| Compound Name | 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide |
| PubChem CID | 6332195 |
| Molecular Formula | C6H7BrNO+ |
| Molecular Weight | 189.03 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide |
| SMILES | CC1C=CC=C(Br)[N+]1=O |
| InChI | InChI=1S/C6H7BrNO/c1-5-3-2-4-6(7)8(5)9/h2-5H,1H3/q+1 |
| InChIKey | ZJWFHAWLNHACJF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide?
The IUPAC name of 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide (CID 6332195) is 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide.
What is the SMILES notation for 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide?
The canonical SMILES for 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide is CC1C=CC=C(Br)[N+]1=O.
What is the InChIKey of 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide?
The InChIKey is ZJWFHAWLNHACJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrNO/c1-5-3-2-4-6(7)8(5)9/h2-5H,1H3/q+1.
What are the key properties of 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide?
6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide has a molecular weight of 189.03 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-methyl-2H-pyridin-1-ium 1-oxide is sourced from PubChem (CID 6332195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).