C7H11N2O+ — CID 6332216
2,6-dimethyl-1-oxo-2H-pyridin-1-ium-4-amine (PubChem CID 6332216) has the molecular formula C7H11N2O+ and a molecular weight of 139.18 g/mol. Its IUPAC name is 2,6-dimethyl-1-oxo-2H-pyridin-1-ium-4-amine.
| Compound Name | 2,6-dimethyl-1-oxo-2H-pyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 6332216 |
| Molecular Formula | C7H11N2O+ |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 2,6-dimethyl-1-oxo-2H-pyridin-1-ium-4-amine |
| SMILES | CC1=CC(N)=CC(C)[N+]1=O |
| InChI | InChI=1S/C7H11N2O/c1-5-3-7(8)4-6(2)9(5)10/h3-5H,8H2,1-2H3/q+1 |
| InChIKey | HZFWNAVCXHPDMT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|