C8H16N4O — CID 63332515
1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol (PubChem CID 63332515) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol.
| Compound Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 63332515 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCc1nncn1C |
| InChI | InChI=1S/C8H16N4O/c1-7(13)5-9-4-3-8-11-10-6-12(8)2/h6-7,9,13H,3-5H2,1-2H3 |
| InChIKey | DJRDSTXXFRTNQS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|