About imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium
imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium (PubChem CID 6333413) has the molecular formula C11H9N4O2+
and a molecular weight of 229.22 g/mol. Its IUPAC name is imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium.
Molecular Properties
| Compound Name | imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium |
| PubChem CID | 6333413 |
| Molecular Formula | C11H9N4O2+ |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium |
| SMILES | Cc1c(N=[N+]=N)c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C11H8N4O2/c1-6-9(14-15-12)11(17)13-8-5-3-2-4-7(8)10(6)16/h2-5,12H,1H3/p+1 |
| InChIKey | AMHKTIDQHXYAIH-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium?
The IUPAC name of imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium (CID 6333413) is imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium.
What is the SMILES notation for imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium?
The canonical SMILES for imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium is Cc1c(N=[N+]=N)c(=O)[nH]c2ccccc2c1=O.
What is the InChIKey of imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium?
The InChIKey is AMHKTIDQHXYAIH-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H8N4O2/c1-6-9(14-15-12)11(17)13-8-5-3-2-4-7(8)10(6)16/h2-5,12H,1H3/p+1.
What are the key properties of imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium?
imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium has a molecular weight of 229.22 g/mol, XLogP of 1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imino-[(4-methyl-2,5-dioxo-1H-1-benzazepin-3-yl)imino]azanium is sourced from PubChem (CID 6333413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).