C13H22N4S2 — CID 63342123
2-[4-(4-ethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-methylpropanethioamide (PubChem CID 63342123) has the molecular formula C13H22N4S2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 2-[4-(4-ethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-methylpropanethioamide.
| Compound Name | 2-[4-(4-ethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 63342123 |
| Molecular Formula | C13H22N4S2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[4-(4-ethyl-1,3-thiazol-2-yl)piperazin-1-yl]-2-methylpropanethioamide |
| SMILES | CCc1csc(N2CCN(C(C)(C)C(N)=S)CC2)n1 |
| InChI | InChI=1S/C13H22N4S2/c1-4-10-9-19-12(15-10)16-5-7-17(8-6-16)13(2,3)11(14)18/h9H,4-8H2,1-3H3,(H2,14,18) |
| InChIKey | MLHLHAMJYHKIRN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|