C17H22N2O2 — CID 63345094
4-[3-(3-phenylpentan-3-yl)-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 63345094) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[3-(3-phenylpentan-3-yl)-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 4-[3-(3-phenylpentan-3-yl)-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 63345094 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-[3-(3-phenylpentan-3-yl)-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | CCC(CC)(c1ccccc1)c1noc(CCC(C)=O)n1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-17(5-2,14-9-7-6-8-10-14)16-18-15(21-19-16)12-11-13(3)20/h6-10H,4-5,11-12H2,1-3H3 |
| InChIKey | JBRUUTKOZWDMBH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |