About 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol
1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 63349567) has the molecular formula C10H8F2N2O2
and a molecular weight of 226.18 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
| PubChem CID | 63349567 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CC(O)c1nc(-c2cc(F)cc(F)c2)no1 |
| InChI | InChI=1S/C10H8F2N2O2/c1-5(15)10-13-9(14-16-10)6-2-7(11)4-8(12)3-6/h2-5,15H,1H3 |
| InChIKey | MYWPTDPRYQPEBM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol?
The IUPAC name of 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol (CID 63349567) is 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol.
What is the SMILES notation for 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol?
The canonical SMILES for 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol is CC(O)c1nc(-c2cc(F)cc(F)c2)no1.
What is the InChIKey of 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol?
The InChIKey is MYWPTDPRYQPEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N2O2/c1-5(15)10-13-9(14-16-10)6-2-7(11)4-8(12)3-6/h2-5,15H,1H3.
What are the key properties of 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol?
1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol has a molecular weight of 226.18 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol is sourced from PubChem (CID 63349567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).