C10H8F2N2O2 — CID 66263724
(1S)-1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 66263724) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is (1S)-1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | (1S)-1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 66263724 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (1S)-1-[3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | C[C@H](O)c1nc(-c2cc(F)cc(F)c2)no1 |
| InChI | InChI=1S/C10H8F2N2O2/c1-5(15)10-13-9(14-16-10)6-2-7(11)4-8(12)3-6/h2-5,15H,1H3/t5-/m0/s1 |
| InChIKey | MYWPTDPRYQPEBM-YFKPBYRVSA-N |
| XLogP | 2.07 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |