C16H18N2OS — CID 63358524
4-amino-N-ethyl-3-(3-methylphenyl)sulfanylbenzamide (PubChem CID 63358524) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-(3-methylphenyl)sulfanylbenzamide.
| Compound Name | 4-amino-N-ethyl-3-(3-methylphenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 63358524 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-amino-N-ethyl-3-(3-methylphenyl)sulfanylbenzamide |
| SMILES | CCNC(=O)c1ccc(N)c(Sc2cccc(C)c2)c1 |
| InChI | InChI=1S/C16H18N2OS/c1-3-18-16(19)12-7-8-14(17)15(10-12)20-13-6-4-5-11(2)9-13/h4-10H,3,17H2,1-2H3,(H,18,19) |
| InChIKey | IFLRLWDLEORKPW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|