C18H19NO2 — CID 63366781
(1R)-1-[3-methoxy-4-(3-phenylprop-2-ynoxy)phenyl]ethanamine (PubChem CID 63366781) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is (1R)-1-[3-methoxy-4-(3-phenylprop-2-ynoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[3-methoxy-4-(3-phenylprop-2-ynoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 63366781 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (1R)-1-[3-methoxy-4-(3-phenylprop-2-ynoxy)phenyl]ethanamine |
| SMILES | COc1cc([C@@H](C)N)ccc1OCC#Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-14(19)16-10-11-17(18(13-16)20-2)21-12-6-9-15-7-4-3-5-8-15/h3-5,7-8,10-11,13-14H,12,19H2,1-2H3/t14-/m1/s1 |
| InChIKey | GDPXJORAZCQUKI-CQSZACIVSA-N |
| XLogP | 3.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|