C16H24N2O2 — CID 63369732
3-amino-6-(2-ethylhexoxy)-1,3-dihydroindol-2-one (PubChem CID 63369732) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-amino-6-(2-ethylhexoxy)-1,3-dihydroindol-2-one.
| Compound Name | 3-amino-6-(2-ethylhexoxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63369732 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-amino-6-(2-ethylhexoxy)-1,3-dihydroindol-2-one |
| SMILES | CCCCC(CC)COc1ccc2c(c1)NC(=O)C2N |
| InChI | InChI=1S/C16H24N2O2/c1-3-5-6-11(4-2)10-20-12-7-8-13-14(9-12)18-16(19)15(13)17/h7-9,11,15H,3-6,10,17H2,1-2H3,(H,18,19) |
| InChIKey | NEGGCNONFUIQAH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |