C14H10Cl2N2O2 — CID 63369969
3-amino-6-(3,5-dichlorophenoxy)-1,3-dihydroindol-2-one (PubChem CID 63369969) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 3-amino-6-(3,5-dichlorophenoxy)-1,3-dihydroindol-2-one.
| Compound Name | 3-amino-6-(3,5-dichlorophenoxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63369969 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 3-amino-6-(3,5-dichlorophenoxy)-1,3-dihydroindol-2-one |
| SMILES | NC1C(=O)Nc2cc(Oc3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C14H10Cl2N2O2/c15-7-3-8(16)5-10(4-7)20-9-1-2-11-12(6-9)18-14(19)13(11)17/h1-6,13H,17H2,(H,18,19) |
| InChIKey | LOZWZKBRBLUGEL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |