About [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol
[4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol (PubChem CID 63376235) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol |
| PubChem CID | 63376235 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol |
| SMILES | CC(N(C)c1cc(CO)nc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O/c1-12(17(2,3)4)19(5)16-10-13(11-20)18-15-9-7-6-8-14(15)16/h6-10,12,20H,11H2,1-5H3 |
| InChIKey | QQANOGOPDMQAOI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol?
The IUPAC name of [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol (CID 63376235) is [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol.
What is the SMILES notation for [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol?
The canonical SMILES for [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol is CC(N(C)c1cc(CO)nc2ccccc12)C(C)(C)C.
What is the InChIKey of [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol?
The InChIKey is QQANOGOPDMQAOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-12(17(2,3)4)19(5)16-10-13(11-20)18-15-9-7-6-8-14(15)16/h6-10,12,20H,11H2,1-5H3.
What are the key properties of [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol?
[4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol has a molecular weight of 272.39 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,3-dimethylbutan-2-yl(methyl)amino]quinolin-2-yl]methanol is sourced from PubChem (CID 63376235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).