4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid

C14H10N2O4 — CID 63382464

IUPAC4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid
SMILESCc1ccoc1-c1nnc(-c2ccc(C(=O)O)cc2)o1
InChIInChI=1S/C14H10N2O4/c1-8-6-7-19-11(8)13-16-15-12(20-13)9-2-4-10(5-3-9)14(17)18/h2-7H,1H3,(H,17,18)
InChIKeyPLTVIVCQWCVZRZ-UHFFFAOYSA-N
MW270.24 g/mol
LogP3.00
Rot. Bonds3

About 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid

4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 63382464) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid.

Molecular Properties

Compound Name4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid
PubChem CID63382464
Molecular FormulaC14H10N2O4
Molecular Weight270.24 g/mol
Exact Mass270.06
IUPAC Name4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid
SMILESCc1ccoc1-c1nnc(-c2ccc(C(=O)O)cc2)o1
InChIInChI=1S/C14H10N2O4/c1-8-6-7-19-11(8)13-16-15-12(20-13)9-2-4-10(5-3-9)14(17)18/h2-7H,1H3,(H,17,18)
InChIKeyPLTVIVCQWCVZRZ-UHFFFAOYSA-N
XLogP3.00
TPSA89.36 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.24
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid?
The IUPAC name of 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid (CID 63382464) is 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid.
What is the SMILES notation for 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid?
The canonical SMILES for 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid is Cc1ccoc1-c1nnc(-c2ccc(C(=O)O)cc2)o1.
What is the InChIKey of 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid?
The InChIKey is PLTVIVCQWCVZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O4/c1-8-6-7-19-11(8)13-16-15-12(20-13)9-2-4-10(5-3-9)14(17)18/h2-7H,1H3,(H,17,18).
What are the key properties of 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid?
4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid has a molecular weight of 270.24 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3-methylfuran-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid is sourced from PubChem (CID 63382464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).