About 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole
2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole (PubChem CID 63383350) has the molecular formula C8H3Cl2IN2S
and a molecular weight of 357.00 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole |
| PubChem CID | 63383350 |
| Molecular Formula | C8H3Cl2IN2S |
| Molecular Weight | 357.00 g/mol |
| Exact Mass | 355.84 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole |
| SMILES | Clc1cccc(Cl)c1-c1nnc(I)s1 |
| InChI | InChI=1S/C8H3Cl2IN2S/c9-4-2-1-3-5(10)6(4)7-12-13-8(11)14-7/h1-3H |
| InChIKey | DOTSVOFYSZFASQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.00 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole?
The IUPAC name of 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole (CID 63383350) is 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole?
The canonical SMILES for 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole is Clc1cccc(Cl)c1-c1nnc(I)s1.
What is the InChIKey of 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole?
The InChIKey is DOTSVOFYSZFASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl2IN2S/c9-4-2-1-3-5(10)6(4)7-12-13-8(11)14-7/h1-3H.
What are the key properties of 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole?
2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole has a molecular weight of 357.00 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-5-iodo-1,3,4-thiadiazole is sourced from PubChem (CID 63383350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).