C10H9IN2O2S — CID 63383412
2-(2,5-dimethoxyphenyl)-5-iodo-1,3,4-thiadiazole (PubChem CID 63383412) has the molecular formula C10H9IN2O2S and a molecular weight of 348.17 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-5-iodo-1,3,4-thiadiazole.
| Compound Name | 2-(2,5-dimethoxyphenyl)-5-iodo-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383412 |
| Molecular Formula | C10H9IN2O2S |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-5-iodo-1,3,4-thiadiazole |
| SMILES | COc1ccc(OC)c(-c2nnc(I)s2)c1 |
| InChI | InChI=1S/C10H9IN2O2S/c1-14-6-3-4-8(15-2)7(5-6)9-12-13-10(11)16-9/h3-5H,1-2H3 |
| InChIKey | LGEHNFBIHBIXHX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|