C12H10N2O2S — CID 82424538
2-(2,5-dimethoxyphenyl)-1,3-thiazole-5-carbonitrile (PubChem CID 82424538) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-(2,5-dimethoxyphenyl)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82424538 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-1,3-thiazole-5-carbonitrile |
| SMILES | COc1ccc(OC)c(-c2ncc(C#N)s2)c1 |
| InChI | InChI=1S/C12H10N2O2S/c1-15-8-3-4-11(16-2)10(5-8)12-14-7-9(6-13)17-12/h3-5,7H,1-2H3 |
| InChIKey | NOCPCQFPUQVQNS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |