C13H12N2O2S — CID 82121444
3-amino-4-(2,5-dimethoxyphenyl)thiophene-2-carbonitrile (PubChem CID 82121444) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-amino-4-(2,5-dimethoxyphenyl)thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-(2,5-dimethoxyphenyl)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 82121444 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-amino-4-(2,5-dimethoxyphenyl)thiophene-2-carbonitrile |
| SMILES | COc1ccc(OC)c(-c2csc(C#N)c2N)c1 |
| InChI | InChI=1S/C13H12N2O2S/c1-16-8-3-4-11(17-2)9(5-8)10-7-18-12(6-14)13(10)15/h3-5,7H,15H2,1-2H3 |
| InChIKey | GSUDYZKVYPBVQC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |