C12H13N5O2S — CID 6338777
[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 6338777) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is [(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 6338777 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)S[C@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H13N5O2S/c13-11(14)16-12(15)20-8-6-9(18)17(10(8)19)7-4-2-1-3-5-7/h1-5,8H,6H2,(H5,13,14,15,16)/t8-/m0/s1 |
| InChIKey | XKKVQHXVMYRNJG-QMMMGPOBSA-N |
| XLogP | 0.26 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|