C20H18N4O4S — CID 92849317
3-[(3R)-2,5-dioxo-3-[N-[(1R)-1-phenylethyl]iminocarbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid (PubChem CID 92849317) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 3-[(3R)-2,5-dioxo-3-[N-[(1R)-1-phenylethyl]iminocarbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[(3R)-2,5-dioxo-3-[N-[(1R)-1-phenylethyl]iminocarbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92849317 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-[(3R)-2,5-dioxo-3-[N-[(1R)-1-phenylethyl]iminocarbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid |
| SMILES | [H]/N=C(\N=N\[C@H](C)c1ccccc1)S[C@@H]1CC(=O)N(c2cccc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C20H18N4O4S/c1-12(13-6-3-2-4-7-13)22-23-20(21)29-16-11-17(25)24(18(16)26)15-9-5-8-14(10-15)19(27)28/h2-10,12,16,21H,11H2,1H3,(H,27,28)/b21-20+,23-22+/t12-,16-/m1/s1 |
| InChIKey | ZAZHRZLVVYXGCW-ZIGGWZTJSA-N |
| XLogP | 3.90 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|