C24H38N2O3Si — CID 634001
5-methoxyimino-2,16-dimethyl-15-trimethylsilyloxy-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile (PubChem CID 634001) has the molecular formula C24H38N2O3Si and a molecular weight of 430.67 g/mol. Its IUPAC name is 5-methoxyimino-2,16-dimethyl-15-trimethylsilyloxy-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile.
| Compound Name | 5-methoxyimino-2,16-dimethyl-15-trimethylsilyloxy-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile |
|---|---|
| PubChem CID | 634001 |
| Molecular Formula | C24H38N2O3Si |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 5-methoxyimino-2,16-dimethyl-15-trimethylsilyloxy-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile |
| SMILES | CON=C1C(C#N)CC2(C)C3CCC4(C)C(O[Si](C)(C)C)CCC4C3CCC23OC13 |
| InChI | InChI=1S/C24H38N2O3Si/c1-22-11-10-18-16(17(22)7-8-19(22)29-30(4,5)6)9-12-24-21(28-24)20(26-27-3)15(14-25)13-23(18,24)2/h15-19,21H,7-13H2,1-6H3 |
| InChIKey | QUEWWGOFCLVAQD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|