C17H18N4O2 — CID 6340360
(2R)-2-(1H-benzimidazol-2-yl)-N'-hydroxy-3-(4-methoxyphenyl)propanimidamide (PubChem CID 6340360) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (2R)-2-(1H-benzimidazol-2-yl)-N'-hydroxy-3-(4-methoxyphenyl)propanimidamide.
| Compound Name | (2R)-2-(1H-benzimidazol-2-yl)-N'-hydroxy-3-(4-methoxyphenyl)propanimidamide |
|---|---|
| PubChem CID | 6340360 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2R)-2-(1H-benzimidazol-2-yl)-N'-hydroxy-3-(4-methoxyphenyl)propanimidamide |
| SMILES | COc1ccc(C[C@@H](/C(N)=N\O)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C17H18N4O2/c1-23-12-8-6-11(7-9-12)10-13(16(18)21-22)17-19-14-4-2-3-5-15(14)20-17/h2-9,13,22H,10H2,1H3,(H2,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | RBIASKMRMMONJK-ZDUSSCGKSA-N |
| XLogP | 2.64 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|