C16H20Cl3N — CID 63425790
N-(2,4,6-trichlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 63425790) has the molecular formula C16H20Cl3N and a molecular weight of 332.70 g/mol. Its IUPAC name is N-(2,4,6-trichlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-(2,4,6-trichlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 63425790 |
| Molecular Formula | C16H20Cl3N |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(2,4,6-trichlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | Clc1cc(Cl)c(NC2CCC3CCCCC3C2)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl3N/c17-12-8-14(18)16(15(19)9-12)20-13-6-5-10-3-1-2-4-11(10)7-13/h8-11,13,20H,1-7H2 |
| InChIKey | KSRSZAFKVNVWRK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |