C15H9Br2ClS — CID 63429257
3-[chloro-(2,5-dibromophenyl)methyl]-1-benzothiophene (PubChem CID 63429257) has the molecular formula C15H9Br2ClS and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-[chloro-(2,5-dibromophenyl)methyl]-1-benzothiophene.
| Compound Name | 3-[chloro-(2,5-dibromophenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 63429257 |
| Molecular Formula | C15H9Br2ClS |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 413.85 |
| IUPAC Name | 3-[chloro-(2,5-dibromophenyl)methyl]-1-benzothiophene |
| SMILES | ClC(c1cc(Br)ccc1Br)c1csc2ccccc12 |
| InChI | InChI=1S/C15H9Br2ClS/c16-9-5-6-13(17)11(7-9)15(18)12-8-19-14-4-2-1-3-10(12)14/h1-8,15H |
| InChIKey | BSKDNVWRZSCIKI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|