C11H6Br3ClS — CID 107964452
2-bromo-4-[chloro-(2,5-dibromophenyl)methyl]thiophene (PubChem CID 107964452) has the molecular formula C11H6Br3ClS and a molecular weight of 445.40 g/mol. Its IUPAC name is 2-bromo-4-[chloro-(2,5-dibromophenyl)methyl]thiophene.
| Compound Name | 2-bromo-4-[chloro-(2,5-dibromophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 107964452 |
| Molecular Formula | C11H6Br3ClS |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 441.74 |
| IUPAC Name | 2-bromo-4-[chloro-(2,5-dibromophenyl)methyl]thiophene |
| SMILES | ClC(c1csc(Br)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H6Br3ClS/c12-7-1-2-9(13)8(4-7)11(15)6-3-10(14)16-5-6/h1-5,11H |
| InChIKey | LBRKDRRELIUCCR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|