C15H16BrClO3 — CID 63433198
3-[(2-bromo-4,5-diethoxyphenyl)-chloromethyl]furan (PubChem CID 63433198) has the molecular formula C15H16BrClO3 and a molecular weight of 359.65 g/mol. Its IUPAC name is 3-[(2-bromo-4,5-diethoxyphenyl)-chloromethyl]furan.
| Compound Name | 3-[(2-bromo-4,5-diethoxyphenyl)-chloromethyl]furan |
|---|---|
| PubChem CID | 63433198 |
| Molecular Formula | C15H16BrClO3 |
| Molecular Weight | 359.65 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 3-[(2-bromo-4,5-diethoxyphenyl)-chloromethyl]furan |
| SMILES | CCOc1cc(Br)c(C(Cl)c2ccoc2)cc1OCC |
| InChI | InChI=1S/C15H16BrClO3/c1-3-19-13-7-11(12(16)8-14(13)20-4-2)15(17)10-5-6-18-9-10/h5-9,15H,3-4H2,1-2H3 |
| InChIKey | HEIDVBHVEKMBFT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|