C15H14BrCl — CID 63437033
1-[bromo-(4-chlorophenyl)methyl]-2,3-dimethylbenzene (PubChem CID 63437033) has the molecular formula C15H14BrCl and a molecular weight of 309.63 g/mol. Its IUPAC name is 1-[bromo-(4-chlorophenyl)methyl]-2,3-dimethylbenzene.
| Compound Name | 1-[bromo-(4-chlorophenyl)methyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 63437033 |
| Molecular Formula | C15H14BrCl |
| Molecular Weight | 309.63 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 1-[bromo-(4-chlorophenyl)methyl]-2,3-dimethylbenzene |
| SMILES | Cc1cccc(C(Br)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C15H14BrCl/c1-10-4-3-5-14(11(10)2)15(16)12-6-8-13(17)9-7-12/h3-9,15H,1-2H3 |
| InChIKey | MMCWYAGRAQYFEU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|