C18H19Cl — CID 176507269
1-[1-(4-chlorophenyl)but-3-enyl]-2,3-dimethylbenzene (PubChem CID 176507269) has the molecular formula C18H19Cl and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)but-3-enyl]-2,3-dimethylbenzene.
| Compound Name | 1-[1-(4-chlorophenyl)but-3-enyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 176507269 |
| Molecular Formula | C18H19Cl |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-[1-(4-chlorophenyl)but-3-enyl]-2,3-dimethylbenzene |
| SMILES | C=CCC(c1ccc(Cl)cc1)c1cccc(C)c1C |
| InChI | InChI=1S/C18H19Cl/c1-4-6-18(15-9-11-16(19)12-10-15)17-8-5-7-13(2)14(17)3/h4-5,7-12,18H,1,6H2,2-3H3 |
| InChIKey | DSGYNVCCHSOYAA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|