C16H17BrO — CID 63439439
2-[bromo(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-3-methylfuran (PubChem CID 63439439) has the molecular formula C16H17BrO and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-[bromo(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-3-methylfuran.
| Compound Name | 2-[bromo(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-3-methylfuran |
|---|---|
| PubChem CID | 63439439 |
| Molecular Formula | C16H17BrO |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[bromo(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]-3-methylfuran |
| SMILES | Cc1ccoc1C(Br)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H17BrO/c1-11-8-9-18-16(11)15(17)14-7-6-12-4-2-3-5-13(12)10-14/h6-10,15H,2-5H2,1H3 |
| InChIKey | MWPPKEQWAFDICD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|