C18H23BrO — CID 63439761
2-[bromo-[2,4-di(propan-2-yl)phenyl]methyl]-3-methylfuran (PubChem CID 63439761) has the molecular formula C18H23BrO and a molecular weight of 335.29 g/mol. Its IUPAC name is 2-[bromo-[2,4-di(propan-2-yl)phenyl]methyl]-3-methylfuran.
| Compound Name | 2-[bromo-[2,4-di(propan-2-yl)phenyl]methyl]-3-methylfuran |
|---|---|
| PubChem CID | 63439761 |
| Molecular Formula | C18H23BrO |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[bromo-[2,4-di(propan-2-yl)phenyl]methyl]-3-methylfuran |
| SMILES | Cc1ccoc1C(Br)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C18H23BrO/c1-11(2)14-6-7-15(16(10-14)12(3)4)17(19)18-13(5)8-9-20-18/h6-12,17H,1-5H3 |
| InChIKey | PJGFBFYIRABGAF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|