C17H25BrO2 — CID 63440289
4-[bromo(cyclobutyl)methyl]-1,2-dipropoxybenzene (PubChem CID 63440289) has the molecular formula C17H25BrO2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 4-[bromo(cyclobutyl)methyl]-1,2-dipropoxybenzene.
| Compound Name | 4-[bromo(cyclobutyl)methyl]-1,2-dipropoxybenzene |
|---|---|
| PubChem CID | 63440289 |
| Molecular Formula | C17H25BrO2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-[bromo(cyclobutyl)methyl]-1,2-dipropoxybenzene |
| SMILES | CCCOc1ccc(C(Br)C2CCC2)cc1OCCC |
| InChI | InChI=1S/C17H25BrO2/c1-3-10-19-15-9-8-14(12-16(15)20-11-4-2)17(18)13-6-5-7-13/h8-9,12-13,17H,3-7,10-11H2,1-2H3 |
| InChIKey | AURMAEVFJMMPTR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|