C18H27ClO2 — CID 83150104
4-(1-chloro-2-cyclopropylpropyl)-1,2-dipropoxybenzene (PubChem CID 83150104) has the molecular formula C18H27ClO2 and a molecular weight of 310.87 g/mol. Its IUPAC name is 4-(1-chloro-2-cyclopropylpropyl)-1,2-dipropoxybenzene.
| Compound Name | 4-(1-chloro-2-cyclopropylpropyl)-1,2-dipropoxybenzene |
|---|---|
| PubChem CID | 83150104 |
| Molecular Formula | C18H27ClO2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-(1-chloro-2-cyclopropylpropyl)-1,2-dipropoxybenzene |
| SMILES | CCCOc1ccc(C(Cl)C(C)C2CC2)cc1OCCC |
| InChI | InChI=1S/C18H27ClO2/c1-4-10-20-16-9-8-15(12-17(16)21-11-5-2)18(19)13(3)14-6-7-14/h8-9,12-14,18H,4-7,10-11H2,1-3H3 |
| InChIKey | WNRQUFUDFNZUOX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|