C18H21ClN2 — CID 63445545
1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2-methyl-3,4-dihydro-2H-quinoline (PubChem CID 63445545) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 63445545 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-2-methyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1cc(C)c(CCl)c(N2c3ccccc3CCC2C)n1 |
| InChI | InChI=1S/C18H21ClN2/c1-12-10-13(2)20-18(16(12)11-19)21-14(3)8-9-15-6-4-5-7-17(15)21/h4-7,10,14H,8-9,11H2,1-3H3 |
| InChIKey | NOPAJMKWGOSKDO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|