About 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran
5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran (PubChem CID 63447838) has the molecular formula C18H27ClO
and a molecular weight of 294.87 g/mol. Its IUPAC name is 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran.
Molecular Properties
| Compound Name | 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran |
| PubChem CID | 63447838 |
| Molecular Formula | C18H27ClO |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CCCCCCCC(Cl)c1ccc2c(c1)CC(C)(C)O2 |
| InChI | InChI=1S/C18H27ClO/c1-4-5-6-7-8-9-16(19)14-10-11-17-15(12-14)13-18(2,3)20-17/h10-12,16H,4-9,13H2,1-3H3 |
| InChIKey | CAIMQJNUKFURKB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran?
The IUPAC name of 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran (CID 63447838) is 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran.
What is the SMILES notation for 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran?
The canonical SMILES for 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran is CCCCCCCC(Cl)c1ccc2c(c1)CC(C)(C)O2.
What is the InChIKey of 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran?
The InChIKey is CAIMQJNUKFURKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27ClO/c1-4-5-6-7-8-9-16(19)14-10-11-17-15(12-14)13-18(2,3)20-17/h10-12,16H,4-9,13H2,1-3H3.
What are the key properties of 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran?
5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran has a molecular weight of 294.87 g/mol, XLogP of 6.04, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-chlorooctyl)-2,2-dimethyl-3H-1-benzofuran is sourced from PubChem (CID 63447838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).