C16H26ClNO — CID 63459202
4-(4-chloro-3-ethylphenoxy)-5,5-dimethylhexan-3-amine (PubChem CID 63459202) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 4-(4-chloro-3-ethylphenoxy)-5,5-dimethylhexan-3-amine.
| Compound Name | 4-(4-chloro-3-ethylphenoxy)-5,5-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 63459202 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 4-(4-chloro-3-ethylphenoxy)-5,5-dimethylhexan-3-amine |
| SMILES | CCc1cc(OC(C(N)CC)C(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C16H26ClNO/c1-6-11-10-12(8-9-13(11)17)19-15(14(18)7-2)16(3,4)5/h8-10,14-15H,6-7,18H2,1-5H3 |
| InChIKey | RCKZEAUBBOBWKW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |