C16H14Cl2N5O3S+ — CID 6346158
[1-amino-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]ethylidene]-(2,4-dichlorophenyl)sulfonylazanium (PubChem CID 6346158) has the molecular formula C16H14Cl2N5O3S+ and a molecular weight of 427.29 g/mol. Its IUPAC name is [1-amino-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]ethylidene]-(2,4-dichlorophenyl)sulfonylazanium.
| Compound Name | [1-amino-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]ethylidene]-(2,4-dichlorophenyl)sulfonylazanium |
|---|---|
| PubChem CID | 6346158 |
| Molecular Formula | C16H14Cl2N5O3S+ |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | [1-amino-2-[(1-phenyl-1,2,4-triazol-3-yl)oxy]ethylidene]-(2,4-dichlorophenyl)sulfonylazanium |
| SMILES | NC(COc1ncn(-c2ccccc2)n1)=[NH+]S(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N5O3S/c17-11-6-7-14(13(18)8-11)27(24,25)22-15(19)9-26-16-20-10-23(21-16)12-4-2-1-3-5-12/h1-8,10H,9H2,(H2,19,22)/p+1 |
| InChIKey | ITQAUMPSDDREDA-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|