C11H17N2O+ — CID 6347155
[1-amino-2-(4-methoxy-2,5-dimethylphenyl)ethylidene]azanium (PubChem CID 6347155) has the molecular formula C11H17N2O+ and a molecular weight of 193.27 g/mol. Its IUPAC name is [1-amino-2-(4-methoxy-2,5-dimethylphenyl)ethylidene]azanium.
| Compound Name | [1-amino-2-(4-methoxy-2,5-dimethylphenyl)ethylidene]azanium |
|---|---|
| PubChem CID | 6347155 |
| Molecular Formula | C11H17N2O+ |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | [1-amino-2-(4-methoxy-2,5-dimethylphenyl)ethylidene]azanium |
| SMILES | COc1cc(C)c(CC(N)=[NH2+])cc1C |
| InChI | InChI=1S/C11H16N2O/c1-7-5-10(14-3)8(2)4-9(7)6-11(12)13/h4-5H,6H2,1-3H3,(H3,12,13)/p+1 |
| InChIKey | OMYXANROWHOJPP-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|