C10H15N2O+ — CID 6347166
[amino-(4-methoxy-2,5-dimethylphenyl)methylidene]azanium (PubChem CID 6347166) has the molecular formula C10H15N2O+ and a molecular weight of 179.24 g/mol. Its IUPAC name is [amino-(4-methoxy-2,5-dimethylphenyl)methylidene]azanium.
| Compound Name | [amino-(4-methoxy-2,5-dimethylphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 6347166 |
| Molecular Formula | C10H15N2O+ |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | [amino-(4-methoxy-2,5-dimethylphenyl)methylidene]azanium |
| SMILES | COc1cc(C)c(C(N)=[NH2+])cc1C |
| InChI | InChI=1S/C10H14N2O/c1-6-5-9(13-3)7(2)4-8(6)10(11)12/h4-5H,1-3H3,(H3,11,12)/p+1 |
| InChIKey | CJLSQVSUUPRYBE-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|