C14H19Br — CID 63471978
4-[(2-bromocyclopentyl)methyl]-1,2-dimethylbenzene (PubChem CID 63471978) has the molecular formula C14H19Br and a molecular weight of 267.21 g/mol. Its IUPAC name is 4-[(2-bromocyclopentyl)methyl]-1,2-dimethylbenzene.
| Compound Name | 4-[(2-bromocyclopentyl)methyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 63471978 |
| Molecular Formula | C14H19Br |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-[(2-bromocyclopentyl)methyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(CC2CCCC2Br)cc1C |
| InChI | InChI=1S/C14H19Br/c1-10-6-7-12(8-11(10)2)9-13-4-3-5-14(13)15/h6-8,13-14H,3-5,9H2,1-2H3 |
| InChIKey | KFJXGGBBBGXQBE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|