C14H13Br2ClN2O — CID 63485313
5-chloro-6-[(2,6-dibromophenoxy)methyl]-N-ethylpyridin-2-amine (PubChem CID 63485313) has the molecular formula C14H13Br2ClN2O and a molecular weight of 420.53 g/mol. Its IUPAC name is 5-chloro-6-[(2,6-dibromophenoxy)methyl]-N-ethylpyridin-2-amine.
| Compound Name | 5-chloro-6-[(2,6-dibromophenoxy)methyl]-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 63485313 |
| Molecular Formula | C14H13Br2ClN2O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 417.91 |
| IUPAC Name | 5-chloro-6-[(2,6-dibromophenoxy)methyl]-N-ethylpyridin-2-amine |
| SMILES | CCNc1ccc(Cl)c(COc2c(Br)cccc2Br)n1 |
| InChI | InChI=1S/C14H13Br2ClN2O/c1-2-18-13-7-6-11(17)12(19-13)8-20-14-9(15)4-3-5-10(14)16/h3-7H,2,8H2,1H3,(H,18,19) |
| InChIKey | TUNABEJPMAYBBI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |