C12H7FI3NO2S — CID 63495225
2-fluoro-N-(2,4,6-triiodophenyl)benzenesulfonamide (PubChem CID 63495225) has the molecular formula C12H7FI3NO2S and a molecular weight of 628.97 g/mol. Its IUPAC name is 2-fluoro-N-(2,4,6-triiodophenyl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(2,4,6-triiodophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63495225 |
| Molecular Formula | C12H7FI3NO2S |
| Molecular Weight | 628.97 g/mol |
| Exact Mass | 628.73 |
| IUPAC Name | 2-fluoro-N-(2,4,6-triiodophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1c(I)cc(I)cc1I)c1ccccc1F |
| InChI | InChI=1S/C12H7FI3NO2S/c13-8-3-1-2-4-11(8)20(18,19)17-12-9(15)5-7(14)6-10(12)16/h1-6,17H |
| InChIKey | LMHSGBHRGWCTOL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|