C16H28BrNS — CID 63507912
2-[(4-bromothiophen-2-yl)methyl]-2-ethyl-N-propan-2-ylhexan-1-amine (PubChem CID 63507912) has the molecular formula C16H28BrNS and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-2-ethyl-N-propan-2-ylhexan-1-amine.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-2-ethyl-N-propan-2-ylhexan-1-amine |
|---|---|
| PubChem CID | 63507912 |
| Molecular Formula | C16H28BrNS |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-2-ethyl-N-propan-2-ylhexan-1-amine |
| SMILES | CCCCC(CC)(CNC(C)C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C16H28BrNS/c1-5-7-8-16(6-2,12-18-13(3)4)10-15-9-14(17)11-19-15/h9,11,13,18H,5-8,10,12H2,1-4H3 |
| InChIKey | SNEGDIPYPCQBQZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |