C17H26F3N — CID 63509368
2-methyl-N-(2-methylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]butan-1-amine (PubChem CID 63509368) has the molecular formula C17H26F3N and a molecular weight of 301.40 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]butan-1-amine.
| Compound Name | 2-methyl-N-(2-methylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 63509368 |
| Molecular Formula | C17H26F3N |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-2-[[4-(trifluoromethyl)phenyl]methyl]butan-1-amine |
| SMILES | CCC(C)(CNCC(C)C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H26F3N/c1-5-16(4,12-21-11-13(2)3)10-14-6-8-15(9-7-14)17(18,19)20/h6-9,13,21H,5,10-12H2,1-4H3 |
| InChIKey | WWYCYWNLSJXVEK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |