C18H27ClO2 — CID 63513543
5-chloro-7-methyl-2,3-dipropoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 63513543) has the molecular formula C18H27ClO2 and a molecular weight of 310.87 g/mol. Its IUPAC name is 5-chloro-7-methyl-2,3-dipropoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-chloro-7-methyl-2,3-dipropoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 63513543 |
| Molecular Formula | C18H27ClO2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 5-chloro-7-methyl-2,3-dipropoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CCCOc1cc2c(cc1OCCC)C(Cl)CC(C)CC2 |
| InChI | InChI=1S/C18H27ClO2/c1-4-8-20-17-11-14-7-6-13(3)10-16(19)15(14)12-18(17)21-9-5-2/h11-13,16H,4-10H2,1-3H3 |
| InChIKey | RWTHCHYBGOJFGG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|