C15H21ClO2 — CID 113305881
1-chloro-6,7-diethoxy-4-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 113305881) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is 1-chloro-6,7-diethoxy-4-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-chloro-6,7-diethoxy-4-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 113305881 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-chloro-6,7-diethoxy-4-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCOc1cc2c(cc1OCC)C(Cl)CCC2C |
| InChI | InChI=1S/C15H21ClO2/c1-4-17-14-8-11-10(3)6-7-13(16)12(11)9-15(14)18-5-2/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | DDCNOMMNVPTXFM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|