C17H18Cl2 — CID 63518283
1-chloro-2-(2-chloro-5-phenylpentyl)benzene (PubChem CID 63518283) has the molecular formula C17H18Cl2 and a molecular weight of 293.24 g/mol. Its IUPAC name is 1-chloro-2-(2-chloro-5-phenylpentyl)benzene.
| Compound Name | 1-chloro-2-(2-chloro-5-phenylpentyl)benzene |
|---|---|
| PubChem CID | 63518283 |
| Molecular Formula | C17H18Cl2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-chloro-2-(2-chloro-5-phenylpentyl)benzene |
| SMILES | Clc1ccccc1CC(Cl)CCCc1ccccc1 |
| InChI | InChI=1S/C17H18Cl2/c18-16(13-15-10-4-5-12-17(15)19)11-6-9-14-7-2-1-3-8-14/h1-5,7-8,10,12,16H,6,9,11,13H2 |
| InChIKey | CFQDSPFVRLCDTA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|