C15H17N3S — CID 63519396
2-(2,3-dimethylanilino)-6-methylpyridine-3-carbothioamide (PubChem CID 63519396) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)-6-methylpyridine-3-carbothioamide.
| Compound Name | 2-(2,3-dimethylanilino)-6-methylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 63519396 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-(2,3-dimethylanilino)-6-methylpyridine-3-carbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(Nc2cccc(C)c2C)n1 |
| InChI | InChI=1S/C15H17N3S/c1-9-5-4-6-13(11(9)3)18-15-12(14(16)19)8-7-10(2)17-15/h4-8H,1-3H3,(H2,16,19)(H,17,18) |
| InChIKey | WKTSNIBNVZESOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|