C14H12F3N3S — CID 63515166
6-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carbothioamide (PubChem CID 63515166) has the molecular formula C14H12F3N3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 6-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carbothioamide.
| Compound Name | 6-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 63515166 |
| Molecular Formula | C14H12F3N3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 6-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H12F3N3S/c1-8-5-6-11(12(18)21)13(19-8)20-10-4-2-3-9(7-10)14(15,16)17/h2-7H,1H3,(H2,18,21)(H,19,20) |
| InChIKey | SUUOMHXVAHICBM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|