C13H11Cl2N3S — CID 55224619
2-(2,3-dichloroanilino)-6-methylpyridine-3-carbothioamide (PubChem CID 55224619) has the molecular formula C13H11Cl2N3S and a molecular weight of 312.23 g/mol. Its IUPAC name is 2-(2,3-dichloroanilino)-6-methylpyridine-3-carbothioamide.
| Compound Name | 2-(2,3-dichloroanilino)-6-methylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 55224619 |
| Molecular Formula | C13H11Cl2N3S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-(2,3-dichloroanilino)-6-methylpyridine-3-carbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(Nc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C13H11Cl2N3S/c1-7-5-6-8(12(16)19)13(17-7)18-10-4-2-3-9(14)11(10)15/h2-6H,1H3,(H2,16,19)(H,17,18) |
| InChIKey | BJPKDSLKJCAEGQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|